Methyl 2-bromothiazole-5-carboxylate
Catalog No: FT-0640215
CAS No: 54045-74-8
- Chemical Name: Methyl 2-bromothiazole-5-carboxylate
- Molecular Formula: C5H4BrNO2S
- Molecular Weight: 222.06
- InChI Key: HNLVIKMXFBRZDF-UHFFFAOYSA-N
- InChI: InChI=1S/C5H4BrNO2S/c1-9-4(8)3-2-7-5(6)10-3/h2H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 78-80ºC |
|---|---|
| CAS: | 54045-74-8 |
| MF: | C5H4BrNO2S |
| Flash_Point: | 117.5±19.8 °C |
| Product_Name: | Methyl 2-bromothiazole-5-carboxylate |
| Density: | 1.8±0.1 g/cm3 |
| FW: | 222.060 |
| Bolling_Point: | 270.7±13.0 °C at 760 mmHg |
| Melting_Point: | 78-80ºC |
|---|---|
| Refractive_Index: | 1.577 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| MF: | C5H4BrNO2S |
| Flash_Point: | 117.5±19.8 °C |
| LogP: | 1.26 |
| FW: | 222.060 |
| Density: | 1.8±0.1 g/cm3 |
| PSA: | 67.43000 |
| Bolling_Point: | 270.7±13.0 °C at 760 mmHg |
| Exact_Mass: | 220.914597 |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Hazard_Codes: | Xi |
| HS_Code: | 2934100090 |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36/37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)